C23H40O11 — CID 162192906
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methylpropyl 2-methylprop-2-enoate;tris(prop-2-enoic acid) (PubChem CID 162192906) has the molecular formula C23H40O11 and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methylpropyl 2-methylprop-2-enoate;tris(prop-2-enoic acid).
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methylpropyl 2-methylprop-2-enoate;tris(prop-2-enoic acid) |
|---|---|
| PubChem CID | 162192906 |
| Molecular Formula | C23H40O11 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-methylpropyl 2-methylprop-2-enoate;tris(prop-2-enoic acid) |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CCC(CO)(CO)CO |
| InChI | InChI=1S/C8H14O2.C6H14O3.3C3H4O2/c1-6(2)5-10-8(9)7(3)4;1-2-6(3-7,4-8)5-9;3*1-2-3(4)5/h6H,3,5H2,1-2,4H3;7-9H,2-5H2,1H3;3*2H,1H2,(H,4,5) |
| InChIKey | ZQNZMBZPVQWFOV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|