C18H34O9 — CID 155101057
ethane-1,2-diol;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate (PubChem CID 155101057) has the molecular formula C18H34O9 and a molecular weight of 394.46 g/mol. Its IUPAC name is ethane-1,2-diol;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate.
| Compound Name | ethane-1,2-diol;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155101057 |
| Molecular Formula | C18H34O9 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | ethane-1,2-diol;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.CCC(CO)(CO)CO.OCCO |
| InChI | InChI=1S/C10H14O4.C6H14O3.C2H6O2/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-2-6(3-7,4-8)5-9;3-1-2-4/h1,3,5-6H2,2,4H3;7-9H,2-5H2,1H3;3-4H,1-2H2 |
| InChIKey | VJJPPKFMPAEJFK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|