C11H20O4 — CID 87795028
[2-(hydroxymethyl)-2-(methoxymethyl)butyl] 2-methylprop-2-enoate (PubChem CID 87795028) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-(methoxymethyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [2-(hydroxymethyl)-2-(methoxymethyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87795028 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | [2-(hydroxymethyl)-2-(methoxymethyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)(CO)COC |
| InChI | InChI=1S/C11H20O4/c1-5-11(6-12,7-14-4)8-15-10(13)9(2)3/h12H,2,5-8H2,1,3-4H3 |
| InChIKey | CSBQYPRQVFVSKX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|