C17H24O6 — CID 67276535
benzoic acid;2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate (PubChem CID 67276535) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is benzoic acid;2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate.
| Compound Name | benzoic acid;2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67276535 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | benzoic acid;2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)(CO)CO.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H18O4.C7H6O2/c1-4-10(5-11,6-12)7-14-9(13)8(2)3;8-7(9)6-4-2-1-3-5-6/h11-12H,2,4-7H2,1,3H3;1-5H,(H,8,9) |
| InChIKey | KBPWTESBQJZSKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|