C41H58O12 — CID 67914765
2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;prop-1-en-2-ylbenzene (PubChem CID 67914765) has the molecular formula C41H58O12 and a molecular weight of 742.90 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;prop-1-en-2-ylbenzene.
| Compound Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 67914765 |
| Molecular Formula | C41H58O12 |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.39 |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyloxymethyl)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C.C=C(C)C(=O)OCCOCCOCCOC(=O)C(=C)C.C=C(C)c1ccccc1 |
| InChI | InChI=1S/C18H26O6.C14H22O6.C9H10/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7;1-11(2)13(15)19-9-7-17-5-6-18-8-10-20-14(16)12(3)4;1-8(2)9-6-4-3-5-7-9/h2,4,6,8-11H2,1,3,5,7H3;1,3,5-10H2,2,4H3;3-7H,1H2,2H3 |
| InChIKey | CJBYBURVNLQRDQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|