C13H26O6 — CID 87376930
2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate;propane-1,2-diol (PubChem CID 87376930) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate;propane-1,2-diol.
| Compound Name | 2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate;propane-1,2-diol |
|---|---|
| PubChem CID | 87376930 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butyl 2-methylprop-2-enoate;propane-1,2-diol |
| SMILES | C=C(C)C(=O)OCC(CC)(CO)CO.CC(O)CO |
| InChI | InChI=1S/C10H18O4.C3H8O2/c1-4-10(5-11,6-12)7-14-9(13)8(2)3;1-3(5)2-4/h11-12H,2,4-7H2,1,3H3;3-5H,2H2,1H3 |
| InChIKey | XDMBPDACVISINL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|