C7H14O5 — CID 87451287
2-methylprop-2-eneperoxoic acid;propane-1,2-diol (PubChem CID 87451287) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is 2-methylprop-2-eneperoxoic acid;propane-1,2-diol.
| Compound Name | 2-methylprop-2-eneperoxoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 87451287 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-methylprop-2-eneperoxoic acid;propane-1,2-diol |
| SMILES | C=C(C)C(=O)OO.CC(O)CO |
| InChI | InChI=1S/C4H6O3.C3H8O2/c1-3(2)4(5)7-6;1-3(5)2-4/h6H,1H2,2H3;3-5H,2H2,1H3 |
| InChIKey | WDDQSLKBTIHDLZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|