C22H54O14 — CID 172778352
2-methylprop-2-enoic acid;hexakis(propane-1,2-diol) (PubChem CID 172778352) has the molecular formula C22H54O14 and a molecular weight of 542.66 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;hexakis(propane-1,2-diol).
| Compound Name | 2-methylprop-2-enoic acid;hexakis(propane-1,2-diol) |
|---|---|
| PubChem CID | 172778352 |
| Molecular Formula | C22H54O14 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 2-methylprop-2-enoic acid;hexakis(propane-1,2-diol) |
| SMILES | C=C(C)C(=O)O.CC(O)CO.CC(O)CO.CC(O)CO.CC(O)CO.CC(O)CO.CC(O)CO |
| InChI | InChI=1S/C4H6O2.6C3H8O2/c1-3(2)4(5)6;6*1-3(5)2-4/h1H2,2H3,(H,5,6);6*3-5H,2H2,1H3 |
| InChIKey | NXIKDXYSDILOPW-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 280.06 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|