C11H19ClO6 — CID 71431738
3-chloropropane-1,2-diol;bis(2-methylprop-2-enoic acid) (PubChem CID 71431738) has the molecular formula C11H19ClO6 and a molecular weight of 282.72 g/mol. Its IUPAC name is 3-chloropropane-1,2-diol;bis(2-methylprop-2-enoic acid).
| Compound Name | 3-chloropropane-1,2-diol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 71431738 |
| Molecular Formula | C11H19ClO6 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-chloropropane-1,2-diol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.OCC(O)CCl |
| InChI | InChI=1S/2C4H6O2.C3H7ClO2/c2*1-3(2)4(5)6;4-1-3(6)2-5/h2*1H2,2H3,(H,5,6);3,5-6H,1-2H2 |
| InChIKey | SXAQBHBHFJPYMZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|