C7H17O9P — CID 122512063
2-methylprop-2-enoic acid;phosphoric acid;propane-1,2,3-triol (PubChem CID 122512063) has the molecular formula C7H17O9P and a molecular weight of 276.18 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;phosphoric acid;propane-1,2,3-triol.
| Compound Name | 2-methylprop-2-enoic acid;phosphoric acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 122512063 |
| Molecular Formula | C7H17O9P |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-methylprop-2-enoic acid;phosphoric acid;propane-1,2,3-triol |
| SMILES | C=C(C)C(=O)O.O=P(O)(O)O.OCC(O)CO |
| InChI | InChI=1S/C4H6O2.C3H8O3.H3O4P/c1-3(2)4(5)6;4-1-3(6)2-5;1-5(2,3)4/h1H2,2H3,(H,5,6);3-6H,1-2H2;(H3,1,2,3,4) |
| InChIKey | KIGGJFIGRRXXHI-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|