C15H26O11 — CID 162197824
butanedioic acid;bis(2-methylprop-2-enoic acid);propane-1,2,3-triol (PubChem CID 162197824) has the molecular formula C15H26O11 and a molecular weight of 382.36 g/mol. Its IUPAC name is butanedioic acid;bis(2-methylprop-2-enoic acid);propane-1,2,3-triol.
| Compound Name | butanedioic acid;bis(2-methylprop-2-enoic acid);propane-1,2,3-triol |
|---|---|
| PubChem CID | 162197824 |
| Molecular Formula | C15H26O11 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | butanedioic acid;bis(2-methylprop-2-enoic acid);propane-1,2,3-triol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=C(O)CCC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C4H6O4.2C4H6O2.C3H8O3/c5-3(6)1-2-4(7)8;2*1-3(2)4(5)6;4-1-3(6)2-5/h1-2H2,(H,5,6)(H,7,8);2*1H2,2H3,(H,5,6);3-6H,1-2H2 |
| InChIKey | ZRELJWZVYSJZCB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|