C28H66O22 — CID 157296752
decanedioic acid;hexakis(propane-1,2,3-triol) (PubChem CID 157296752) has the molecular formula C28H66O22 and a molecular weight of 754.81 g/mol. Its IUPAC name is decanedioic acid;hexakis(propane-1,2,3-triol).
| Compound Name | decanedioic acid;hexakis(propane-1,2,3-triol) |
|---|---|
| PubChem CID | 157296752 |
| Molecular Formula | C28H66O22 |
| Molecular Weight | 754.81 g/mol |
| Exact Mass | 754.40 |
| IUPAC Name | decanedioic acid;hexakis(propane-1,2,3-triol) |
| SMILES | O=C(O)CCCCCCCCC(=O)O.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO |
| InChI | InChI=1S/C10H18O4.6C3H8O3/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;6*4-1-3(6)2-5/h1-8H2,(H,11,12)(H,13,14);6*3-6H,1-2H2 |
| InChIKey | BBKYYJLHXALTHU-UHFFFAOYSA-N |
| XLogP | -7.73 |
| TPSA | 438.74 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.81 |
| LogP ≤ 5 | -7.73 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|