C16H32O10 — CID 160502483
decanedioic acid;2-hydroxypropanoic acid;propane-1,2,3-triol (PubChem CID 160502483) has the molecular formula C16H32O10 and a molecular weight of 384.42 g/mol. Its IUPAC name is decanedioic acid;2-hydroxypropanoic acid;propane-1,2,3-triol.
| Compound Name | decanedioic acid;2-hydroxypropanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 160502483 |
| Molecular Formula | C16H32O10 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | decanedioic acid;2-hydroxypropanoic acid;propane-1,2,3-triol |
| SMILES | CC(O)C(=O)O.O=C(O)CCCCCCCCC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C10H18O4.C3H8O3.C3H6O3/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;4-1-3(6)2-5;1-2(4)3(5)6/h1-8H2,(H,11,12)(H,13,14);3-6H,1-2H2;2,4H,1H3,(H,5,6) |
| InChIKey | QRYSFSRTFZFMTG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|