C32H66O12 — CID 175774423
decanedioic acid;hexadecanoic acid;bis(propane-1,2,3-triol) (PubChem CID 175774423) has the molecular formula C32H66O12 and a molecular weight of 642.87 g/mol. Its IUPAC name is decanedioic acid;hexadecanoic acid;bis(propane-1,2,3-triol).
| Compound Name | decanedioic acid;hexadecanoic acid;bis(propane-1,2,3-triol) |
|---|---|
| PubChem CID | 175774423 |
| Molecular Formula | C32H66O12 |
| Molecular Weight | 642.87 g/mol |
| Exact Mass | 642.46 |
| IUPAC Name | decanedioic acid;hexadecanoic acid;bis(propane-1,2,3-triol) |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O.OCC(O)CO.OCC(O)CO |
| InChI | InChI=1S/C16H32O2.C10H18O4.2C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*4-1-3(6)2-5/h2-15H2,1H3,(H,17,18);1-8H2,(H,11,12)(H,13,14);2*3-6H,1-2H2 |
| InChIKey | QLVCHSLZIBRXMZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 233.28 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|