C48H116O34 — CID 173290043
decanoic acid;octanoic acid;decakis(propane-1,2,3-triol) (PubChem CID 173290043) has the molecular formula C48H116O34 and a molecular weight of 1237.42 g/mol. Its IUPAC name is decanoic acid;octanoic acid;decakis(propane-1,2,3-triol).
| Compound Name | decanoic acid;octanoic acid;decakis(propane-1,2,3-triol) |
|---|---|
| PubChem CID | 173290043 |
| Molecular Formula | C48H116O34 |
| Molecular Weight | 1237.42 g/mol |
| Exact Mass | 1236.73 |
| IUPAC Name | decanoic acid;octanoic acid;decakis(propane-1,2,3-triol) |
| SMILES | CCCCCCCC(=O)O.CCCCCCCCCC(=O)O.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO.OCC(O)CO |
| InChI | InChI=1S/C10H20O2.C8H16O2.10C3H8O3/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;10*4-1-3(6)2-5/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);10*3-6H,1-2H2 |
| InChIKey | YVFLCLZVAASCDZ-UHFFFAOYSA-N |
| XLogP | -11.04 |
| TPSA | 681.50 Ų |
| H-Bond Donors | 32 |
| H-Bond Acceptors | 32 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1237.42 |
| LogP ≤ 5 | -11.04 |
| H-Bond Donors ≤ 5 | 32 |
| H-Bond Acceptors ≤ 10 | 32 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|