C13H27NO5 — CID 174805554
1-methylpiperidine;2-methylprop-2-enoic acid;propane-1,2,3-triol (PubChem CID 174805554) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-methylpiperidine;2-methylprop-2-enoic acid;propane-1,2,3-triol.
| Compound Name | 1-methylpiperidine;2-methylprop-2-enoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174805554 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 1-methylpiperidine;2-methylprop-2-enoic acid;propane-1,2,3-triol |
| SMILES | C=C(C)C(=O)O.CN1CCCCC1.OCC(O)CO |
| InChI | InChI=1S/C6H13N.C4H6O2.C3H8O3/c1-7-5-3-2-4-6-7;1-3(2)4(5)6;4-1-3(6)2-5/h2-6H2,1H3;1H2,2H3,(H,5,6);3-6H,1-2H2 |
| InChIKey | FOULQVPRSMAMGK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|