C7H15O8P — CID 159257312
2,3-dihydroxypropyl dihydrogen phosphate;2-methylprop-2-enoic acid (PubChem CID 159257312) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is 2,3-dihydroxypropyl dihydrogen phosphate;2-methylprop-2-enoic acid.
| Compound Name | 2,3-dihydroxypropyl dihydrogen phosphate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 159257312 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2,3-dihydroxypropyl dihydrogen phosphate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=P(O)(O)OCC(O)CO |
| InChI | InChI=1S/C4H6O2.C3H9O6P/c1-3(2)4(5)6;4-1-3(5)2-9-10(6,7)8/h1H2,2H3,(H,5,6);3-5H,1-2H2,(H2,6,7,8) |
| InChIKey | KWBFYXIWOJBPHA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|