C8H23NO7P+ — CID 87187110
2,3-dihydroxypropyl dihydrogen phosphate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 87187110) has the molecular formula C8H23NO7P+ and a molecular weight of 276.25 g/mol. Its IUPAC name is 2,3-dihydroxypropyl dihydrogen phosphate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2,3-dihydroxypropyl dihydrogen phosphate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 87187110 |
| Molecular Formula | C8H23NO7P+ |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2,3-dihydroxypropyl dihydrogen phosphate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=P(O)(O)OCC(O)CO |
| InChI | InChI=1S/C5H14NO.C3H9O6P/c1-6(2,3)4-5-7;4-1-3(5)2-9-10(6,7)8/h7H,4-5H2,1-3H3;3-5H,1-2H2,(H2,6,7,8)/q+1; |
| InChIKey | PUKALBKVVHSDQX-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|