C8H21NO6P+ — CID 174875717
2-(2-hydroxy-3-phosphonooxypropoxy)ethyl-trimethylazanium (PubChem CID 174875717) has the molecular formula C8H21NO6P+ and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phosphonooxypropoxy)ethyl-trimethylazanium.
| Compound Name | 2-(2-hydroxy-3-phosphonooxypropoxy)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 174875717 |
| Molecular Formula | C8H21NO6P+ |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(2-hydroxy-3-phosphonooxypropoxy)ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C8H20NO6P/c1-9(2,3)4-5-14-6-8(10)7-15-16(11,12)13/h8,10H,4-7H2,1-3H3,(H-,11,12,13)/p+1 |
| InChIKey | RBJQMDCQILKINY-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|