C5H16Cl2NO4P — CID 87786144
trimethyl(2-phosphonooxyethyl)azanium;chloride;hydrochloride (PubChem CID 87786144) has the molecular formula C5H16Cl2NO4P and a molecular weight of 256.07 g/mol. Its IUPAC name is trimethyl(2-phosphonooxyethyl)azanium;chloride;hydrochloride.
| Compound Name | trimethyl(2-phosphonooxyethyl)azanium;chloride;hydrochloride |
|---|---|
| PubChem CID | 87786144 |
| Molecular Formula | C5H16Cl2NO4P |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | trimethyl(2-phosphonooxyethyl)azanium;chloride;hydrochloride |
| SMILES | C[N+](C)(C)CCOP(=O)(O)O.Cl.[Cl-] |
| InChI | InChI=1S/C5H14NO4P.2ClH/c1-6(2,3)4-5-10-11(7,8)9;;/h4-5H2,1-3H3,(H-,7,8,9);2*1H |
| InChIKey | WFNWUOQRKHJJGA-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|