C11H25ClNO11P — CID 87760482
2,3-dihydroxypropanoyl 2,3-dihydroxypropanoate;trimethyl(2-phosphonooxyethyl)azanium;chloride (PubChem CID 87760482) has the molecular formula C11H25ClNO11P and a molecular weight of 413.74 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl 2,3-dihydroxypropanoate;trimethyl(2-phosphonooxyethyl)azanium;chloride.
| Compound Name | 2,3-dihydroxypropanoyl 2,3-dihydroxypropanoate;trimethyl(2-phosphonooxyethyl)azanium;chloride |
|---|---|
| PubChem CID | 87760482 |
| Molecular Formula | C11H25ClNO11P |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2,3-dihydroxypropanoyl 2,3-dihydroxypropanoate;trimethyl(2-phosphonooxyethyl)azanium;chloride |
| SMILES | C[N+](C)(C)CCOP(=O)(O)O.O=C(OC(=O)C(O)CO)C(O)CO.[Cl-] |
| InChI | InChI=1S/C6H10O7.C5H14NO4P.ClH/c7-1-3(9)5(11)13-6(12)4(10)2-8;1-6(2,3)4-5-10-11(7,8)9;/h3-4,7-10H,1-2H2;4-5H2,1-3H3,(H-,7,8,9);1H |
| InChIKey | PARFMPIIAVMGIZ-UHFFFAOYSA-N |
| XLogP | -6.43 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|