C12H27NO6P+ — CID 162176524
2-[(2-hydroxy-3-propanoyloxypropoxy)-methylphosphoryl]oxyethyl-trimethylazanium (PubChem CID 162176524) has the molecular formula C12H27NO6P+ and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-propanoyloxypropoxy)-methylphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(2-hydroxy-3-propanoyloxypropoxy)-methylphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 162176524 |
| Molecular Formula | C12H27NO6P+ |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[(2-hydroxy-3-propanoyloxypropoxy)-methylphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC(=O)OCC(O)COP(C)(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H27NO6P/c1-6-12(15)17-9-11(14)10-19-20(5,16)18-8-7-13(2,3)4/h11,14H,6-10H2,1-5H3/q+1 |
| InChIKey | AFKSMNJTAYKDBR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|