C12H26NO7P — CID 134433135
(3-butanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134433135) has the molecular formula C12H26NO7P and a molecular weight of 327.31 g/mol. Its IUPAC name is (3-butanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | (3-butanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134433135 |
| Molecular Formula | C12H26NO7P |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3-butanoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC(=O)OCC(O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H26NO7P/c1-5-6-12(15)18-9-11(14)10-20-21(16,17)19-8-7-13(2,3)4/h11,14H,5-10H2,1-4H3 |
| InChIKey | YOLSCEBOFNSEKU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|