C30H50NO7P — CID 72732764
(3-docosa-4,7,10,13,16,19-hexaenoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 72732764) has the molecular formula C30H50NO7P and a molecular weight of 567.70 g/mol. Its IUPAC name is (3-docosa-4,7,10,13,16,19-hexaenoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | (3-docosa-4,7,10,13,16,19-hexaenoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 72732764 |
| Molecular Formula | C30H50NO7P |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | (3-docosa-4,7,10,13,16,19-hexaenoyloxy-2-hydroxypropyl) 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C30H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30(33)36-27-29(32)28-38-39(34,35)37-26-25-31(2,3)4/h6-7,9-10,12-13,15-16,18-19,21-22,29,32H,5,8,11,14,17,20,23-28H2,1-4H3 |
| InChIKey | LSOWKZULVQWMLY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|