C11H28NO8P — CID 174901552
propane-1,2,3-triol;propan-2-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate (PubChem CID 174901552) has the molecular formula C11H28NO8P and a molecular weight of 333.32 g/mol. Its IUPAC name is propane-1,2,3-triol;propan-2-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate.
| Compound Name | propane-1,2,3-triol;propan-2-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 174901552 |
| Molecular Formula | C11H28NO8P |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | propane-1,2,3-triol;propan-2-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
| SMILES | CC(C)=O.C[N+](C)(C)CCOP(=O)([O-])O.OCC(O)CO |
| InChI | InChI=1S/C5H14NO4P.C3H8O3.C3H6O/c1-6(2,3)4-5-10-11(7,8)9;4-1-3(6)2-5;1-3(2)4/h4-5H2,1-3H3,(H-,7,8,9);3-6H,1-2H2;1-2H3 |
| InChIKey | QEODMFSTDNDZLM-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|