C12H29N2O6P — CID 87534294
2-acetyloxyethyl(trimethyl)azanium;2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 87534294) has the molecular formula C12H29N2O6P and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-acetyloxyethyl(trimethyl)azanium;2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-acetyloxyethyl(trimethyl)azanium;2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 87534294 |
| Molecular Formula | C12H29N2O6P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC(=O)OCC[N+](C)(C)C.C[N+](C)(C)CCOP(=O)([O-])[O-] |
| InChI | InChI=1S/C7H16NO2.C5H14NO4P/c1-7(9)10-6-5-8(2,3)4;1-6(2,3)4-5-10-11(7,8)9/h5-6H2,1-4H3;4-5H2,1-3H3,(H-,7,8,9)/q+1;/p-1 |
| InChIKey | CZDILLJMKZJQGU-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|