About 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid
2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid (PubChem CID 158766752) has the molecular formula C10H22NO5+
and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid |
| PubChem CID | 158766752 |
| Molecular Formula | C10H22NO5+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid |
| SMILES | CC(=O)OCC[N+](C)(C)C.CC(O)C(=O)O |
| InChI | InChI=1S/C7H16NO2.C3H6O3/c1-7(9)10-6-5-8(2,3)4;1-2(4)3(5)6/h5-6H2,1-4H3;2,4H,1H3,(H,5,6)/q+1; |
| InChIKey | IPIXADMSGWHOMI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid?
The IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid (CID 158766752) is 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid.
What is the SMILES notation for 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid?
The canonical SMILES for 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid is CC(=O)OCC[N+](C)(C)C.CC(O)C(=O)O.
What is the InChIKey of 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid?
The InChIKey is IPIXADMSGWHOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16NO2.C3H6O3/c1-7(9)10-6-5-8(2,3)4;1-2(4)3(5)6/h5-6H2,1-4H3;2,4H,1H3,(H,5,6)/q+1;.
What are the key properties of 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid?
2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid has a molecular weight of 236.29 g/mol, XLogP of -0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl(trimethyl)azanium;2-hydroxypropanoic acid is sourced from PubChem (CID 158766752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).