C18H36N2O12+2 — CID 175886232
2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium (PubChem CID 175886232) has the molecular formula C18H36N2O12+2 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175886232 |
| Molecular Formula | C18H36N2O12+2 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)C(O)C(O)C(=O)O.C[N+](C)(C)CCOC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/2C9H17NO6/c2*1-10(2,3)4-5-16-9(15)7(12)6(11)8(13)14/h2*6-7,11-12H,4-5H2,1-3H3/p+2 |
| InChIKey | VVATWKWJVITVBF-UHFFFAOYSA-P |
| XLogP | -3.92 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|