C9H16O6 — CID 141434844
(2R,3R)-2,3-dihydroxy-4-(3-methylbutoxy)-4-oxobutanoic acid (PubChem CID 141434844) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-4-(3-methylbutoxy)-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2,3-dihydroxy-4-(3-methylbutoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141434844 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-4-(3-methylbutoxy)-4-oxobutanoic acid |
| SMILES | CC(C)CCOC(=O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H16O6/c1-5(2)3-4-15-9(14)7(11)6(10)8(12)13/h5-7,10-11H,3-4H2,1-2H3,(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | FBMJLJVJKYPFEF-RNFRBKRXSA-N |
| XLogP | -0.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |