C10H20N2O12 — CID 133126863
bis((2S,3S)-2,3-dihydroxybutanedioic acid);ethane-1,2-diamine (PubChem CID 133126863) has the molecular formula C10H20N2O12 and a molecular weight of 360.27 g/mol. Its IUPAC name is bis((2S,3S)-2,3-dihydroxybutanedioic acid);ethane-1,2-diamine.
| Compound Name | bis((2S,3S)-2,3-dihydroxybutanedioic acid);ethane-1,2-diamine |
|---|---|
| PubChem CID | 133126863 |
| Molecular Formula | C10H20N2O12 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | bis((2S,3S)-2,3-dihydroxybutanedioic acid);ethane-1,2-diamine |
| SMILES | NCCN.O=C(O)[C@@H](O)[C@H](O)C(=O)O.O=C(O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/2C4H6O6.C2H8N2/c2*5-1(3(7)8)2(6)4(9)10;3-1-2-4/h2*1-2,5-6H,(H,7,8)(H,9,10);1-4H2/t2*1-,2-;/m00./s1 |
| InChIKey | RWISDUHFHDEVCZ-TYNZFUTISA-N |
| XLogP | -5.34 |
| TPSA | 282.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |