C14H32N2O7+2 — CID 118341268
2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium;2-hydroxyethyl(trimethyl)azanium (PubChem CID 118341268) has the molecular formula C14H32N2O7+2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 118341268 |
| Molecular Formula | C14H32N2O7+2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(3-carboxy-2,3-dihydroxypropanoyl)oxyethyl-trimethylazanium;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCOC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H17NO6.C5H14NO/c1-10(2,3)4-5-16-9(15)7(12)6(11)8(13)14;1-6(2,3)4-5-7/h6-7,11-12H,4-5H2,1-3H3;7H,4-5H2,1-3H3/q;+1/p+1 |
| InChIKey | VINBQQKJARKYMI-UHFFFAOYSA-O |
| XLogP | -2.27 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|