About 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide
2-hydroxyethyl(trimethyl)azanium;urea;hydroxide (PubChem CID 175396514) has the molecular formula C6H19N3O3
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide |
| PubChem CID | 175396514 |
| Molecular Formula | C6H19N3O3 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide |
| SMILES | C[N+](C)(C)CCO.NC(N)=O.[OH-] |
| InChI | InChI=1S/C5H14NO.CH4N2O.H2O/c1-6(2,3)4-5-7;2-1(3)4;/h7H,4-5H2,1-3H3;(H4,2,3,4);1H2/q+1;;/p-1 |
| InChIKey | RIRKVQNUSFCETF-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide?
The IUPAC name of 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide (CID 175396514) is 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide.
What is the SMILES notation for 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide?
The canonical SMILES for 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide is C[N+](C)(C)CCO.NC(N)=O.[OH-].
What is the InChIKey of 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide?
The InChIKey is RIRKVQNUSFCETF-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.CH4N2O.H2O/c1-6(2,3)4-5-7;2-1(3)4;/h7H,4-5H2,1-3H3;(H4,2,3,4);1H2/q+1;;/p-1.
What are the key properties of 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide?
2-hydroxyethyl(trimethyl)azanium;urea;hydroxide has a molecular weight of 181.24 g/mol, XLogP of -1.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trimethyl)azanium;urea;hydroxide is sourced from PubChem (CID 175396514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).