About bis(2-hydroxyethyl(trimethyl)azanium);carbonate
bis(2-hydroxyethyl(trimethyl)azanium);carbonate (PubChem CID 11701720) has the molecular formula C11H28N2O5
and a molecular weight of 268.35 g/mol. Its IUPAC name is bis(2-hydroxyethyl(trimethyl)azanium);carbonate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl(trimethyl)azanium);carbonate |
| PubChem CID | 11701720 |
| Molecular Formula | C11H28N2O5 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | bis(2-hydroxyethyl(trimethyl)azanium);carbonate |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=C([O-])[O-] |
| InChI | InChI=1S/2C5H14NO.CH2O3/c2*1-6(2,3)4-5-7;2-1(3)4/h2*7H,4-5H2,1-3H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | QNBZBQZEELNQPW-UHFFFAOYSA-L |
| XLogP | -3.08 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl(trimethyl)azanium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl(trimethyl)azanium);carbonate?
The IUPAC name of bis(2-hydroxyethyl(trimethyl)azanium);carbonate (CID 11701720) is bis(2-hydroxyethyl(trimethyl)azanium);carbonate.
What is the SMILES notation for bis(2-hydroxyethyl(trimethyl)azanium);carbonate?
The canonical SMILES for bis(2-hydroxyethyl(trimethyl)azanium);carbonate is C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=C([O-])[O-].
What is the InChIKey of bis(2-hydroxyethyl(trimethyl)azanium);carbonate?
The InChIKey is QNBZBQZEELNQPW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H14NO.CH2O3/c2*1-6(2,3)4-5-7;2-1(3)4/h2*7H,4-5H2,1-3H3;(H2,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(2-hydroxyethyl(trimethyl)azanium);carbonate?
bis(2-hydroxyethyl(trimethyl)azanium);carbonate has a molecular weight of 268.35 g/mol, XLogP of -3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl(trimethyl)azanium);carbonate is sourced from PubChem (CID 11701720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).