C10H23NO3 — CID 21472941
2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 21472941) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 21472941 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(C)(C)C(=O)[O-].C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C5H10O2/c1-6(2,3)4-5-7;1-5(2,3)4(6)7/h7H,4-5H2,1-3H3;1-3H3,(H,6,7)/q+1;/p-1 |
| InChIKey | HPMGUEYSNMHNIM-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|