About 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium
2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 21472941) has the molecular formula C10H23NO3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 21472941 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(C)(C)C(=O)[O-].C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C5H10O2/c1-6(2,3)4-5-7;1-5(2,3)4(6)7/h7H,4-5H2,1-3H3;1-3H3,(H,6,7)/q+1;/p-1 |
| InChIKey | HPMGUEYSNMHNIM-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium (CID 21472941) is 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium is CC(C)(C)C(=O)[O-].C[N+](C)(C)CCO.
What is the InChIKey of 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is HPMGUEYSNMHNIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.C5H10O2/c1-6(2,3)4-5-7;1-5(2,3)4(6)7/h7H,4-5H2,1-3H3;1-3H3,(H,6,7)/q+1;/p-1.
What are the key properties of 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium?
2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 205.30 g/mol, XLogP of -0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 21472941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).