C18H38N2O11+2 — CID 11952950
[(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2,3-dihydroxybutanedioic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 11952950) has the molecular formula C18H38N2O11+2 and a molecular weight of 458.51 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2,3-dihydroxybutanedioic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2,3-dihydroxybutanedioic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 11952950 |
| Molecular Formula | C18H38N2O11+2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2,3-dihydroxybutanedioic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.C[N+](C)(C)CCO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H17NO4.C5H14NO.C4H6O6/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;1-6(2,3)4-5-7;5-1(3(7)8)2(6)4(9)10/h8H,5-6H2,1-4H3;7H,4-5H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/q;+1;/p+1/t8-;;/m1../s1 |
| InChIKey | KOXCWKCABUPHBP-YCBDHFTFSA-O |
| XLogP | -2.34 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|