C13H22NO8+ — CID 10286492
[(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;(E)-but-2-enedioic acid (PubChem CID 10286492) has the molecular formula C13H22NO8+ and a molecular weight of 320.32 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;(E)-but-2-enedioic acid.
| Compound Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 10286492 |
| Molecular Formula | C13H22NO8+ |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;(E)-but-2-enedioic acid |
| SMILES | CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H17NO4.C4H4O4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;5-3(6)1-2-4(7)8/h8H,5-6H2,1-4H3;1-2H,(H,5,6)(H,7,8)/p+1/b;2-1+/t8-;/m1./s1 |
| InChIKey | YAWYRGBPGBNSRQ-XQGNFNNSSA-O |
| XLogP | -0.19 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|