C18H32N2O8+2 — CID 53252491
[(2S)-3-carboxy-2-[(E)-4-[(2S)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-4-oxobut-2-enoyl]oxypropyl]-trimethylazanium (PubChem CID 53252491) has the molecular formula C18H32N2O8+2 and a molecular weight of 404.46 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-[(E)-4-[(2S)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-4-oxobut-2-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2S)-3-carboxy-2-[(E)-4-[(2S)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-4-oxobut-2-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 53252491 |
| Molecular Formula | C18H32N2O8+2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [(2S)-3-carboxy-2-[(E)-4-[(2S)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-4-oxobut-2-enoyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@H](CC(=O)O)OC(=O)/C=C/C(=O)O[C@@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C18H30N2O8/c1-19(2,3)11-13(9-15(21)22)27-17(25)7-8-18(26)28-14(10-16(23)24)12-20(4,5)6/h7-8,13-14H,9-12H2,1-6H3/p+2/b8-7+/t13-,14-/m0/s1 |
| InChIKey | BKTAOZMPIACPMH-SWICKSTGSA-P |
| XLogP | -0.27 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|