C19H36NO4+ — CID 88861957
[(2R)-3-carboxy-2-[(E)-dodec-2-enoyl]oxypropyl]-trimethylazanium (PubChem CID 88861957) has the molecular formula C19H36NO4+ and a molecular weight of 342.50 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(E)-dodec-2-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(E)-dodec-2-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 88861957 |
| Molecular Formula | C19H36NO4+ |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | [(2R)-3-carboxy-2-[(E)-dodec-2-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCCCCC/C=C/C(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C19H35NO4/c1-5-6-7-8-9-10-11-12-13-14-19(23)24-17(15-18(21)22)16-20(2,3)4/h13-14,17H,5-12,15-16H2,1-4H3/p+1/b14-13+/t17-/m1/s1 |
| InChIKey | OWRLUKFWNGLGIE-TUQDCPSNSA-O |
| XLogP | 3.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|