C19H32NO6+ — CID 156961849
[3-carboxy-2-[(2E,6E)-11-carboxyundeca-2,6-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 156961849) has the molecular formula C19H32NO6+ and a molecular weight of 370.47 g/mol. Its IUPAC name is [3-carboxy-2-[(2E,6E)-11-carboxyundeca-2,6-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(2E,6E)-11-carboxyundeca-2,6-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156961849 |
| Molecular Formula | C19H32NO6+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [3-carboxy-2-[(2E,6E)-11-carboxyundeca-2,6-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)/C=C/CC/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C19H31NO6/c1-20(2,3)15-16(14-18(23)24)26-19(25)13-11-9-7-5-4-6-8-10-12-17(21)22/h4-5,11,13,16H,6-10,12,14-15H2,1-3H3,(H-,21,22,23,24)/p+1/b5-4+,13-11+ |
| InChIKey | ANDHJBPFHRVELN-FPHDLJRASA-O |
| XLogP | 2.62 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|