C23H40NO4+ — CID 156962302
[3-carboxy-2-[(6E,10E,14E)-hexadeca-6,10,14-trienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962302) has the molecular formula C23H40NO4+ and a molecular weight of 394.58 g/mol. Its IUPAC name is [3-carboxy-2-[(6E,10E,14E)-hexadeca-6,10,14-trienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(6E,10E,14E)-hexadeca-6,10,14-trienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962302 |
| Molecular Formula | C23H40NO4+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | [3-carboxy-2-[(6E,10E,14E)-hexadeca-6,10,14-trienoyl]oxypropyl]-trimethylazanium |
| SMILES | C/C=C/CC/C=C/CC/C=C/CCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H39NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)28-21(19-22(25)26)20-24(2,3)4/h5-6,9-10,13-14,21H,7-8,11-12,15-20H2,1-4H3/p+1/b6-5+,10-9+,14-13+ |
| InChIKey | ZHQJBIQDKNBFDS-ITJAWTGISA-O |
| XLogP | 4.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|