C16H28NO4+ — CID 156962747
[3-carboxy-2-[(5E,7E)-nona-5,7-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962747) has the molecular formula C16H28NO4+ and a molecular weight of 298.40 g/mol. Its IUPAC name is [3-carboxy-2-[(5E,7E)-nona-5,7-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(5E,7E)-nona-5,7-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962747 |
| Molecular Formula | C16H28NO4+ |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [3-carboxy-2-[(5E,7E)-nona-5,7-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | C/C=C/C=C/CCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H27NO4/c1-5-6-7-8-9-10-11-16(20)21-14(12-15(18)19)13-17(2,3)4/h5-8,14H,9-13H2,1-4H3/p+1/b6-5+,8-7+ |
| InChIKey | YJKHKJMSLNDXED-BSWSSELBSA-O |
| XLogP | 2.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|