C21H34NO6+ — CID 156962156
[3-carboxy-2-[(6E,8E,10E)-13-carboxytrideca-6,8,10-trienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962156) has the molecular formula C21H34NO6+ and a molecular weight of 396.50 g/mol. Its IUPAC name is [3-carboxy-2-[(6E,8E,10E)-13-carboxytrideca-6,8,10-trienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(6E,8E,10E)-13-carboxytrideca-6,8,10-trienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962156 |
| Molecular Formula | C21H34NO6+ |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [3-carboxy-2-[(6E,8E,10E)-13-carboxytrideca-6,8,10-trienoyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CCCC/C=C/C=C/C=C/CCC(=O)O |
| InChI | InChI=1S/C21H33NO6/c1-22(2,3)17-18(16-20(25)26)28-21(27)15-13-11-9-7-5-4-6-8-10-12-14-19(23)24/h4-8,10,18H,9,11-17H2,1-3H3,(H-,23,24,25,26)/p+1/b6-4+,7-5+,10-8+ |
| InChIKey | OLVRAYHDTOHUES-KJVLDDSZSA-O |
| XLogP | 3.17 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|