C23H39NO6 — CID 156962279
3-[(4E,6E)-15-carboxypentadeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962279) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is 3-[(4E,6E)-15-carboxypentadeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(4E,6E)-15-carboxypentadeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962279 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 3-[(4E,6E)-15-carboxypentadeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CC/C=C/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H39NO6/c1-24(2,3)19-20(18-22(27)28)30-23(29)17-15-13-11-9-7-5-4-6-8-10-12-14-16-21(25)26/h7,9,11,13,20H,4-6,8,10,12,14-19H2,1-3H3,(H-,25,26,27,28)/b9-7+,13-11+ |
| InChIKey | CADSMMGHUHQCLA-PTSVWTKZSA-N |
| XLogP | 2.84 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|