C18H31NO6 — CID 156961675
3-[(E)-10-carboxydec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961675) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-[(E)-10-carboxydec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-10-carboxydec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961675 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 3-[(E)-10-carboxydec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCC/C=C/CCCC(=O)O |
| InChI | InChI=1S/C18H31NO6/c1-19(2,3)14-15(13-17(22)23)25-18(24)12-10-8-6-4-5-7-9-11-16(20)21/h4-5,15H,6-14H2,1-3H3,(H-,20,21,22,23)/b5-4+ |
| InChIKey | ZJOUXSYZMKVKKA-SNAWJCMRSA-N |
| XLogP | 1.12 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|