C21H37NO7 — CID 156962054
3-[(E)-13-carboxy-3-hydroxytridec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962054) has the molecular formula C21H37NO7 and a molecular weight of 415.53 g/mol. Its IUPAC name is 3-[(E)-13-carboxy-3-hydroxytridec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-13-carboxy-3-hydroxytridec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962054 |
| Molecular Formula | C21H37NO7 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 3-[(E)-13-carboxy-3-hydroxytridec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CC(O)/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C21H37NO7/c1-22(2,3)16-18(15-20(26)27)29-21(28)14-17(23)12-10-8-6-4-5-7-9-11-13-19(24)25/h10,12,17-18,23H,4-9,11,13-16H2,1-3H3,(H-,24,25,26,27)/b12-10+ |
| InChIKey | WLQZNBSFIALQGI-ZRDIBKRKSA-N |
| XLogP | 1.26 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|