C23H43NO5 — CID 130276205
3-[(Z)-16-hydroxyhexadec-9-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 130276205) has the molecular formula C23H43NO5 and a molecular weight of 413.60 g/mol. Its IUPAC name is 3-[(Z)-16-hydroxyhexadec-9-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(Z)-16-hydroxyhexadec-9-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 130276205 |
| Molecular Formula | C23H43NO5 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | 3-[(Z)-16-hydroxyhexadec-9-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCCCC/C=C\CCCCCCO |
| InChI | InChI=1S/C23H43NO5/c1-24(2,3)20-21(19-22(26)27)29-23(28)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-25/h4,6,21,25H,5,7-20H2,1-3H3/b6-4- |
| InChIKey | SBLUGLLPBKEJRH-XQRVVYSFSA-N |
| XLogP | 2.97 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|