C22H35NO6 — CID 156962221
3-[(3E,5E,7E)-14-carboxytetradeca-3,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962221) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 3-[(3E,5E,7E)-14-carboxytetradeca-3,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(3E,5E,7E)-14-carboxytetradeca-3,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962221 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 3-[(3E,5E,7E)-14-carboxytetradeca-3,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)C/C=C/C=C/C=C/CCCCCCC(=O)O |
| InChI | InChI=1S/C22H35NO6/c1-23(2,3)18-19(17-21(26)27)29-22(28)16-14-12-10-8-6-4-5-7-9-11-13-15-20(24)25/h4,6,8,10,12,14,19H,5,7,9,11,13,15-18H2,1-3H3,(H-,24,25,26,27)/b6-4+,10-8+,14-12+ |
| InChIKey | DNBDXDFDQPTIDJ-WHVLXAOPSA-N |
| XLogP | 2.23 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|