C21H36NO6+ — CID 156962097
[3-carboxy-2-[(9E,11E)-13-carboxytrideca-9,11-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962097) has the molecular formula C21H36NO6+ and a molecular weight of 398.52 g/mol. Its IUPAC name is [3-carboxy-2-[(9E,11E)-13-carboxytrideca-9,11-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(9E,11E)-13-carboxytrideca-9,11-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962097 |
| Molecular Formula | C21H36NO6+ |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [3-carboxy-2-[(9E,11E)-13-carboxytrideca-9,11-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CCCCCCC/C=C/C=C/CC(=O)O |
| InChI | InChI=1S/C21H35NO6/c1-22(2,3)17-18(16-20(25)26)28-21(27)15-13-11-9-7-5-4-6-8-10-12-14-19(23)24/h6,8,10,12,18H,4-5,7,9,11,13-17H2,1-3H3,(H-,23,24,25,26)/p+1/b8-6+,12-10+ |
| InChIKey | IHBMRIURPIFEMA-VTKKNFPDSA-O |
| XLogP | 3.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|