C23H38NO4+ — CID 138153222
[3-carboxy-2-[(7Z,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl]-trimethylazanium (PubChem CID 138153222) has the molecular formula C23H38NO4+ and a molecular weight of 392.56 g/mol. Its IUPAC name is [3-carboxy-2-[(7Z,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(7Z,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 138153222 |
| Molecular Formula | C23H38NO4+ |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | [3-carboxy-2-[(7Z,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C\C=C/CCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H37NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)28-21(19-22(25)26)20-24(2,3)4/h6-13,21H,5,14-20H2,1-4H3/p+1/b7-6+,9-8+,11-10-,13-12- |
| InChIKey | FLSWPCVBMCCOSN-OCADGTSTSA-O |
| XLogP | 4.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|