C19H35NO7 — CID 156961895
3-(11-carboxy-5-hydroxyundecanoyl)oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961895) has the molecular formula C19H35NO7 and a molecular weight of 389.49 g/mol. Its IUPAC name is 3-(11-carboxy-5-hydroxyundecanoyl)oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(11-carboxy-5-hydroxyundecanoyl)oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961895 |
| Molecular Formula | C19H35NO7 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-(11-carboxy-5-hydroxyundecanoyl)oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCC(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C19H35NO7/c1-20(2,3)14-16(13-18(24)25)27-19(26)12-8-10-15(21)9-6-4-5-7-11-17(22)23/h15-16,21H,4-14H2,1-3H3,(H-,22,23,24,25) |
| InChIKey | VMBDTDYJBZAONM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|